EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H22O4/c1-3-5-8-12(4-2)11-20-16(19)14-10-7-6-9-13(14)15(17)18/h6-7,9-10,12H,3-5,8,11H2,1-2H3,(H,17,18) |
| InChIKey | DJDSLBVSSOQSLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono(2-ethylhexyl) phthalate (CHEBI:17243) has functional parent 2-ethylhexan-1-ol (CHEBI:16011) |
| mono(2-ethylhexyl) phthalate (CHEBI:17243) is a phthalic acid monoester (CHEBI:132610) |
| mono(2-ethylhexyl) phthalate (CHEBI:17243) is conjugate acid of mono(2-ethylhexyl) phthalate(1−) (CHEBI:58071) |
| Incoming Relation(s) |
| mono(2-ethylhexyl) phthalate(1−) (CHEBI:58071) is conjugate base of mono(2-ethylhexyl) phthalate (CHEBI:17243) |
| IUPAC Name |
|---|
| 2-(2-ethylhexyloxycarbonyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-benzenedicarboxylic acid, mono(2-ethylhexyl) ester | NIST Chemistry WebBook |
| 2-([(2-ethylhexyl)oxy]carbonyl)benzoic acid | NIST Chemistry WebBook |
| (2-ethylhexyl) hydrogen phthalate | ChemIDplus |
| 2-ethylhexyl hydrogen phthalate | ChemIDplus |
| 2-Ethylhexyl phthalate | KEGG COMPOUND |
| MEHP | NIST Chemistry WebBook |