EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18O |
| Net Charge | 0 |
| Average Mass | 130.231 |
| Monoisotopic Mass | 130.13577 |
| SMILES | CCCCC(CC)CO |
| InChI | InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | YIWUKEYIRIRTPP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylhexan-1-ol (CHEBI:16011) has role plant metabolite (CHEBI:76924) |
| 2-ethylhexan-1-ol (CHEBI:16011) has role volatile oil component (CHEBI:27311) |
| 2-ethylhexan-1-ol (CHEBI:16011) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 2-ethylhexyl sulfate (CHEBI:88117) has functional parent 2-ethylhexan-1-ol (CHEBI:16011) |
| bis(2-ethylhexyl) adipate (CHEBI:34675) has functional parent 2-ethylhexan-1-ol (CHEBI:16011) |
| isatinone B (CHEBI:66088) has functional parent 2-ethylhexan-1-ol (CHEBI:16011) |
| mono(2-ethylhexyl) phthalate (CHEBI:17243) has functional parent 2-ethylhexan-1-ol (CHEBI:16011) |
| IUPAC Name |
|---|
| 2-ethylhexan-1-ol |
| Synonyms | Source |
|---|---|
| 2-ethyl-1-hexanol | ChEBI |
| 2-Ethyl-1-hexanol | KEGG COMPOUND |
| 2-Ethylhexan-1-ol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-ethylhexan-1-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-Ethylhexanol | Wikipedia |
| C02498 | KEGG COMPOUND |
| C02498 | KEGG COMPOUND |
| HMDB0031231 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1719280 | Reaxys |
| CAS:104-76-7 | KEGG COMPOUND |
| Citations |
|---|