EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17129 - (S)-scoulerine
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(O)c3CN1CCc1cc(OC)c(O)cc12 |
| InChI | InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | KNWVMRVOBAFFMH-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis scouleri (IPNI:66415-2) | - | PubMed (22029392) | |
| Corydalis cava (IPNI:672129-1) | - | PubMed (22029392) |
| Roles Classification |
|---|
| Biological Roles: | EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-scoulerine (CHEBI:17129) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| (S)-scoulerine (CHEBI:17129) has role plant metabolite (CHEBI:76924) |
| (S)-scoulerine (CHEBI:17129) is a berberine alkaloid (CHEBI:22754) |
| (S)-scoulerine (CHEBI:17129) is a organic heterotetracyclic compound (CHEBI:38163) |
| Incoming Relation(s) |
| cyclanoline (CHEBI:76923) has functional parent (S)-scoulerine (CHEBI:17129) |
| IUPAC Name |
|---|
| (13aS)-3,10-dimethoxy-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinoline-2,9-diol |
| Synonyms | Source |
|---|---|
| (S)-Scoulerine | KEGG COMPOUND |
| (13aS)-5,8,13,13a-tetrahydro-3,10-dimethoxy-6H-dibenzo[a,g]quinolizine-2,9-diol | KEGG COMPOUND |
| (S)-scoulerine | ChEBI |
| (−)-scoulerine | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-scoulerine | UniProt |
| Citations |
|---|