EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)COC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-4(8)1-3(6(11)12)13-2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CIOXZGOUEYHNBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (carboxymethoxy)succinic acid (CHEBI:17040) has functional parent succinic acid (CHEBI:15741) |
| (carboxymethoxy)succinic acid (CHEBI:17040) is a tricarboxylic acid (CHEBI:27093) |
| (carboxymethoxy)succinic acid (CHEBI:17040) is conjugate acid of 2-(carboxylatomethoxy)succinate(3−) (CHEBI:57992) |
| Incoming Relation(s) |
| 2-(carboxylatomethoxy)succinate(3−) (CHEBI:57992) is conjugate base of (carboxymethoxy)succinic acid (CHEBI:17040) |
| IUPAC Name |
|---|
| 2-(carboxymethoxy)butanedioic acid |
| Synonyms | Source |
|---|---|
| (Carboxymethoxy) succinic acid | KEGG COMPOUND |
| Carboxymethyloxysuccinate | KEGG COMPOUND |