EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17NO6 |
| Net Charge | 0 |
| Average Mass | 379.368 |
| Monoisotopic Mass | 379.10559 |
| SMILES | COc1cc2c(c3c1-c1cc(O)c4cc5c(cc4c1N(C)C3)OCO5)OCO2 |
| InChI | InChI=1S/C21H17NO6/c1-22-7-13-19(17(24-2)6-18-21(13)28-9-27-18)12-3-14(23)10-4-15-16(26-8-25-15)5-11(10)20(12)22/h3-6,23H,7-9H2,1-2H3 |
| InChIKey | LEHAJESKGINQOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-hydroxydihydrochelirubine (CHEBI:15716) has functional parent chelirubine (CHEBI:17031) |
| 12-hydroxydihydrochelirubine (CHEBI:15716) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 5-methoxy-13-methyl-13,14-dihydro-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-7-ol |
| Synonyms | Source |
|---|---|
| 12-Hydroxychelirubine | KEGG COMPOUND |
| 12-Hydroxydihydrochelirubine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 12-hydroxydihydrochelirubine | UniProt |