EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15FN3O15P3 |
| Net Charge | 0 |
| Average Mass | 529.156 |
| Monoisotopic Mass | 528.97000 |
| SMILES | NC(=O)c1nc(F)cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C10H15FN3O15P3/c11-4-1-14(9(18)5(13-4)8(12)17)10-7(16)6(15)3(27-10)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,3,6-7,10,15-16H,2H2,(H2,12,17)(H,22,23)(H,24,25)(H2,19,20,21)/t3-,6-,7-,10-/m1/s1 |
| InChIKey | UUKPXXBDUCDZDA-KAFVXXCXSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a RNA-directed RNA polymerase (EC 2.7.7.48). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| favipiravir-RTP (CHEBI:170009) has functional parent favipiravir (CHEBI:134722) |
| favipiravir-RTP (CHEBI:170009) has role anticoronaviral agent (CHEBI:149553) |
| favipiravir-RTP (CHEBI:170009) has role antiviral drug (CHEBI:36044) |
| favipiravir-RTP (CHEBI:170009) has role EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor (CHEBI:170010) |
| favipiravir-RTP (CHEBI:170009) is a nucleoside analogue (CHEBI:60783) |
| favipiravir-RTP (CHEBI:170009) is a organic triphosphate (CHEBI:62894) |
| favipiravir-RTP (CHEBI:170009) is a organofluorine compound (CHEBI:37143) |
| favipiravir-RTP (CHEBI:170009) is a primary carboxamide (CHEBI:140324) |
| favipiravir-RTP (CHEBI:170009) is a pyrazinone (CHEBI:167376) |
| IUPAC Name |
|---|
| 6-fluoro-4-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-β-D-ribofuranosyl]-3-oxo-3,4-dihydropyrazine-2-carboxamide |
| Synonyms | Source |
|---|---|
| 6-fluoro-3,4-dihydro-4-(5-O-(hydroxy((hydroxy(phosphonooxy)phosphinyl)oxy)phosphinyl)-β-D-ribofuranosyl)-3-oxo-2-pyrazinecarboxamide | ChemIDplus |
| favipiravir riboside triphosphate | ChemIDplus |
| Favipiravir-rtp | ChEMBL |
| T-705-4-ribofuranosyl-5'-triphosphate | ChEBI |
| T-705 ribosyl triphosphate | ChEBI |
| T-705 RTP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| GE6 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:740790-94-7 | ChemIDplus |
| Citations |
|---|