EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4FN3O2 |
| Net Charge | 0 |
| Average Mass | 157.104 |
| Monoisotopic Mass | 157.02875 |
| SMILES | NC(=O)c1nc(F)cnc1O |
| InChI | InChI=1S/C5H4FN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) |
| InChIKey | ZCGNOVWYSGBHAU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a RNA-directed RNA polymerase (EC 2.7.7.48). antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| favipiravir (CHEBI:134722) has role anticoronaviral agent (CHEBI:149553) |
| favipiravir (CHEBI:134722) has role antiviral drug (CHEBI:36044) |
| favipiravir (CHEBI:134722) has role EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor (CHEBI:170010) |
| favipiravir (CHEBI:134722) is a hydroxypyrazine (CHEBI:71633) |
| favipiravir (CHEBI:134722) is a organofluorine compound (CHEBI:37143) |
| favipiravir (CHEBI:134722) is a primary carboxamide (CHEBI:140324) |
| Incoming Relation(s) |
| favipiravir-RTP (CHEBI:170009) has functional parent favipiravir (CHEBI:134722) |
| IUPAC Name |
|---|
| 6-fluoro-3-hydroxypyrazine-2-carboxamide |
| INNs | Source |
|---|---|
| favipiravir | WHO MedNet |
| favipiravir | WHO MedNet |
| favipiravir | WHO MedNet |
| favipiravirum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-fluoro-3-hydroxy-2-pyrazinecarboxamide | ChemIDplus |
| fapilavir | DrugBank |
| T 705 | ChemIDplus |
| T-705 | ChemIDplus |
| T705 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Areplivir | ChEBI |
| Avifavir | ChEBI |
| Avigan | KEGG DRUG |
| Favilavir | ChEBI |
| Favipira | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 431002 | ChemSpider |
| 4887 | DrugCentral |
| D09537 | KEGG DRUG |
| DB12466 | DrugBank |
| Favipiravir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9697246 | Reaxys |
| CAS:259793-96-9 | ChemIDplus |
| Citations |
|---|