EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O5 |
| Net Charge | 0 |
| Average Mass | 206.198 |
| Monoisotopic Mass | 206.09027 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H]([NH3+])CO)C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O5/c1-3(11)5(7(13)14)9-6(12)4(8)2-10/h3-5,10-11H,2,8H2,1H3,(H,9,12)(H,13,14)/t3-,4+,5+/m1/s1 |
| InChIKey | LDEBVRIURYMKQS-WISUUJSJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Thr zwitterion (CHEBI:169955) is a dipeptide zwitterion (CHEBI:90799) |
| Ser-Thr zwitterion (CHEBI:169955) is tautomer of Ser-Thr (CHEBI:141393) |
| Incoming Relation(s) |
| Ser-Thr (CHEBI:141393) is tautomer of Ser-Thr zwitterion (CHEBI:169955) |
| IUPAC Name |
|---|
| (2S,3R)-2-{[(2S)-2-azaniumyl-3-hydroxypropanoyl]amino}-3-hydroxybutanoate |
| Synonyms | Source |
|---|---|
| L-seryl-L-threonine zwitterion | ChEBI |
| L-Ser-L-Thr zwitterion | ChEBI |
| S-T zwitterion | ChEBI |
| ST zwitterion | ChEBI |
| serinylthreonine zwitterion | ChEBI |
| H-Ser-Thr-OH zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-seryl-L-threonine | UniProt |
| Citations |
|---|