EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O5 |
| Net Charge | 0 |
| Average Mass | 206.198 |
| Monoisotopic Mass | 206.09027 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C7H14N2O5/c1-3(11)5(7(13)14)9-6(12)4(8)2-10/h3-5,10-11H,2,8H2,1H3,(H,9,12)(H,13,14)/t3-,4+,5+/m1/s1 |
| InChIKey | LDEBVRIURYMKQS-WISUUJSJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Thr (CHEBI:141393) has functional parent L-serine (CHEBI:17115) |
| Ser-Thr (CHEBI:141393) has functional parent L-threonine (CHEBI:16857) |
| Ser-Thr (CHEBI:141393) is a dipeptide (CHEBI:46761) |
| Ser-Thr (CHEBI:141393) is tautomer of Ser-Thr zwitterion (CHEBI:169955) |
| Incoming Relation(s) |
| Ser-Thr zwitterion (CHEBI:169955) is tautomer of Ser-Thr (CHEBI:141393) |
| IUPAC Name |
|---|
| L-seryl-L-threonine |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-{[(2S)-2-amino-3-hydroxypropanoyl]amino}-3-hydroxybutanoic acid | IUPAC |
| H-Ser-Thr-OH | ChEBI |
| serine threonine dipeptide | HMDB |
| serinylthreonine | SUBMITTER |
| L-Ser-L-Thr | SUBMITTER |
| S-T | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029049 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27312726 | Reaxys |