EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O5 |
| Net Charge | 0 |
| Average Mass | 360.450 |
| Monoisotopic Mass | 360.19367 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
| InChIKey | MFYSYFVPBJMHGN-ZPOLXVRWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortisone (CHEBI:16962) has parent hydride pregnane (CHEBI:8386) |
| cortisone (CHEBI:16962) has role analgesic (CHEBI:35480) |
| cortisone (CHEBI:16962) has role anti-inflammatory agent (CHEBI:67079) |
| cortisone (CHEBI:16962) has role human metabolite (CHEBI:77746) |
| cortisone (CHEBI:16962) has role mouse metabolite (CHEBI:75771) |
| cortisone (CHEBI:16962) is a 11-oxo steroid (CHEBI:47787) |
| cortisone (CHEBI:16962) is a 17α-hydroxy steroid (CHEBI:35342) |
| cortisone (CHEBI:16962) is a 20-oxo steroid (CHEBI:36885) |
| cortisone (CHEBI:16962) is a 21-hydroxy steroid (CHEBI:35344) |
| cortisone (CHEBI:16962) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cortisone (CHEBI:16962) is a C21-steroid (CHEBI:61313) |
| cortisone (CHEBI:16962) is a glucocorticoid (CHEBI:24261) |
| cortisone (CHEBI:16962) is a primary α-hydroxy ketone (CHEBI:139590) |
| cortisone (CHEBI:16962) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| 20β-hydroxycortisone (CHEBI:178084) has functional parent cortisone (CHEBI:16962) |
| 4,5-dihydrocortisone (CHEBI:23736) has functional parent cortisone (CHEBI:16962) |
| 6β-hydroxycortisone (CHEBI:139269) has functional parent cortisone (CHEBI:16962) |
| hydrocortamate (CHEBI:50851) has functional parent cortisone (CHEBI:16962) |
| IUPAC Name |
|---|
| 17,21-dihydroxypregn-4-ene-3,11,20-trione |
| Synonyms | Source |
|---|---|
| 11-dehydro-17-hydroxycorticosterone | ChemIDplus |
| 17alpha,21-Dihydroxy-4-pregnene-3,11,20-trione | KEGG COMPOUND |
| 17-hydroxy-11-dehydrocorticosterone | ChemIDplus |
| 17α,21-dihydroxy-4-pregnene-3,11,20-trione | NIST Chemistry WebBook |
| 4-pregnene-17α,21-diol-3,11,20-trione | NIST Chemistry WebBook |
| Cortison | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| cortisone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00762 | KEGG COMPOUND |
| Cortisone | Wikipedia |
| CORTISONE | MetaCyc |
| D07749 | KEGG DRUG |
| HMDB0002802 | HMDB |
| LMST02030090 | LIPID MAPS |
| Citations |
|---|