EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O6 |
| Net Charge | 0 |
| Average Mass | 376.449 |
| Monoisotopic Mass | 376.18859 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])C[C@@H](O)C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H28O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h7,12-13,15,18,22,24,27H,3-6,8-10H2,1-2H3/t12-,13-,15+,18+,19-,20-,21-/m0/s1 |
| InChIKey | BCHHPSBWEQCAPG-WTCKOWDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (19959402) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | probe A role played by a molecular entity used to study the microscopic environment. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6β-hydroxycortisone (CHEBI:139269) has functional parent cortisone (CHEBI:16962) |
| 6β-hydroxycortisone (CHEBI:139269) has role human metabolite (CHEBI:77746) |
| 6β-hydroxycortisone (CHEBI:139269) has role probe (CHEBI:50406) |
| 6β-hydroxycortisone (CHEBI:139269) is a 11-oxo steroid (CHEBI:47787) |
| 6β-hydroxycortisone (CHEBI:139269) is a 17α-hydroxy steroid (CHEBI:35342) |
| 6β-hydroxycortisone (CHEBI:139269) is a 20-oxo steroid (CHEBI:36885) |
| 6β-hydroxycortisone (CHEBI:139269) is a 21-hydroxy steroid (CHEBI:35344) |
| 6β-hydroxycortisone (CHEBI:139269) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 6β-hydroxycortisone (CHEBI:139269) is a 6β-hydroxy steroid (CHEBI:36851) |
| 6β-hydroxycortisone (CHEBI:139269) is a C21-steroid (CHEBI:61313) |
| 6β-hydroxycortisone (CHEBI:139269) is a primary α-hydroxy ketone (CHEBI:139590) |
| 6β-hydroxycortisone (CHEBI:139269) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 6β,17,21-trihydroxypregn-4-ene-3,11,20-trione |
| Synonym | Source |
|---|---|
| 6β-17α,21-trihydroxypregn-4-ene-3,11,20-trione | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 6β-hydroxycortisone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3177303 | Reaxys |
| Citations |
|---|