EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | CC1=CC2=C(C)C(=O)C(C)(O)C(O)C2=CO1 |
| InChI | InChI=1S/C12H14O4/c1-6-4-8-7(2)10(13)12(3,15)11(14)9(8)5-16-6/h4-5,11,14-15H,1-3H3 |
| InChIKey | JVUYBLROBHJEJN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrodeoxy-8-epiaustdiol (CHEBI:168623) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| 7,8-dihydroxy-3,5,7-trimethyl-8H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 35013376 | ChemSpider |
| HMDB0031668 | HMDB |