EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O6 |
| Net Charge | 0 |
| Average Mass | 430.541 |
| Monoisotopic Mass | 430.23554 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C[C@]4(C)C(C)=C(C(=O)O)C(=O)C(C)=C4O3)[C@@]1(C)CCC(=O)OC2(C)C |
| InChI | InChI=1S/C25H34O6/c1-13-8-9-16-22(4,5)30-17(26)10-11-24(16,7)25(13)12-23(6)15(3)18(21(28)29)19(27)14(2)20(23)31-25/h13,16H,8-12H2,1-7H3,(H,28,29)/t13-,16-,23+,24-,25-/m0/s1 |
| InChIKey | CQIYAXMUJHIADR-CQOOHDILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus novofumigatus IBT 16806 (ncbitaxon:1392255) | - | PubMed (29968715) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnovolin I (CHEBI:167909) has role Aspergillus metabolite (CHEBI:76956) |
| asnovolin I (CHEBI:167909) is a cyclic ketone (CHEBI:3992) |
| asnovolin I (CHEBI:167909) is a meroterpenoid (CHEBI:64419) |
| asnovolin I (CHEBI:167909) is a monocarboxylic acid (CHEBI:25384) |
| asnovolin I (CHEBI:167909) is a organic heterotetracyclic compound (CHEBI:38163) |
| asnovolin I (CHEBI:167909) is a ε-lactone (CHEBI:50239) |
| asnovolin I (CHEBI:167909) is conjugate acid of asnovolin I(1−) (CHEBI:167684) |
| Incoming Relation(s) |
| asnovolin I(1−) (CHEBI:167684) is conjugate base of asnovolin I (CHEBI:167909) |
| IUPAC Name |
|---|
| (2S,3aR,5a'S,7'S,9a'R)-1',1',3a,4,5a',7,7'-heptamethyl-3',6-dioxo-3',3a,4',5',5a',6,7',8',9',9a'-decahydro-1'H,3H-spiro[[1]benzofuran-2,6'-[2]benzoxepine]-5-carboxylic acid |
| Citations |
|---|