EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33O6 |
| Net Charge | -1 |
| Average Mass | 429.533 |
| Monoisotopic Mass | 429.22826 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C[C@]4(C)C(C)=C(C(=O)[O-])C(=O)C(C)=C4O3)[C@@]1(C)CCC(=O)OC2(C)C |
| InChI | InChI=1S/C25H34O6/c1-13-8-9-16-22(4,5)30-17(26)10-11-24(16,7)25(13)12-23(6)15(3)18(21(28)29)19(27)14(2)20(23)31-25/h13,16H,8-12H2,1-7H3,(H,28,29)/p-1/t13-,16-,23+,24-,25-/m0/s1 |
| InChIKey | CQIYAXMUJHIADR-CQOOHDILSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnovolin I(1−) (CHEBI:167684) is a monocarboxylic acid anion (CHEBI:35757) |
| asnovolin I(1−) (CHEBI:167684) is conjugate base of asnovolin I (CHEBI:167909) |
| Incoming Relation(s) |
| asnovolin I (CHEBI:167909) is conjugate acid of asnovolin I(1−) (CHEBI:167684) |
| IUPAC Name |
|---|
| (2S,3aR,5a'S,7'S,9a'R)-1',1',3a,4,5a',7,7'-heptamethyl-3',6-dioxo-3',3a,4',5',5a',6,7',8',9',9a'-decahydro-1'H,3H-spiro[[1]benzofuran-2,6'-[2]benzoxepine]-5-carboxylate |
| Synonym | Source |
|---|---|
| asnovolin I anion | ChEBI |
| UniProt Name | Source |
|---|---|
| asnovolin I | UniProt |
| Citations |
|---|