EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19FN4O3 |
| Net Charge | 0 |
| Average Mass | 370.384 |
| Monoisotopic Mass | 370.14412 |
| SMILES | Cc1cc2c(F)c(Oc3ncnn4cc(OC[C@@H](C)O)c(C)c34)ccc2n1 |
| InChI | InChI=1S/C19H19FN4O3/c1-10-6-13-14(23-10)4-5-15(17(13)20)27-19-18-12(3)16(26-8-11(2)25)7-24(18)22-9-21-19/h4-7,9,11,23,25H,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | WCWUXEGQKLTGDX-LLVKDONJSA-N |
| Roles Classification |
|---|
| Biological Roles: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brivanib (CHEBI:167686) has role angiogenesis inhibitor (CHEBI:48422) |
| brivanib (CHEBI:167686) has role antineoplastic agent (CHEBI:35610) |
| brivanib (CHEBI:167686) has role apoptosis inducer (CHEBI:68495) |
| brivanib (CHEBI:167686) has role drug metabolite (CHEBI:49103) |
| brivanib (CHEBI:167686) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| brivanib (CHEBI:167686) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| brivanib (CHEBI:167686) is a aromatic ether (CHEBI:35618) |
| brivanib (CHEBI:167686) is a diether (CHEBI:46786) |
| brivanib (CHEBI:167686) is a fluoroindole (CHEBI:131960) |
| brivanib (CHEBI:167686) is a pyrrolotriazine (CHEBI:88341) |
| brivanib (CHEBI:167686) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| brivanib alaninate (CHEBI:167656) has functional parent brivanib (CHEBI:167686) |
| IUPAC Name |
|---|
| (2R)-1-({4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl}oxy)propan-2-ol |
| Synonyms | Source |
|---|---|
| BMS-540215 | ChemIDplus |
| BMS 540215 | ChemIDplus |
| BMS540215 | ChemIDplus |
| (R)-1-(4-(4-fluoro-2-methyl-1H-indol-5-yloxy)-5- methylpyrrolo[2,1-f][1,2,4]triazin-6-yloxy)propan- 2-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB11958 | DrugBank |
| D09589 | KEGG DRUG |
| 9409099 | ChemSpider |
| WO2011044019 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:649735-46-6 | ChemIDplus |
| Citations |
|---|