EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24FN5O4 |
| Net Charge | 0 |
| Average Mass | 441.463 |
| Monoisotopic Mass | 441.18123 |
| SMILES | Cc1cc2c(F)c(Oc3ncnn4cc(OC[C@@H](C)OC(=O)[C@H](C)N)c(C)c34)ccc2n1 |
| InChI | InChI=1S/C22H24FN5O4/c1-11-7-15-16(27-11)5-6-17(19(15)23)32-21-20-13(3)18(8-28(20)26-10-25-21)30-9-12(2)31-22(29)14(4)24/h5-8,10,12,14,27H,9,24H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | LTEJRLHKIYCEOX-OCCSQVGLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brivanib alaninate (CHEBI:167656) has functional parent brivanib (CHEBI:167686) |
| brivanib alaninate (CHEBI:167656) has role angiogenesis inhibitor (CHEBI:48422) |
| brivanib alaninate (CHEBI:167656) has role antineoplastic agent (CHEBI:35610) |
| brivanib alaninate (CHEBI:167656) has role apoptosis inducer (CHEBI:68495) |
| brivanib alaninate (CHEBI:167656) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| brivanib alaninate (CHEBI:167656) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| brivanib alaninate (CHEBI:167656) has role prodrug (CHEBI:50266) |
| brivanib alaninate (CHEBI:167656) is a L-alanine derivative (CHEBI:83943) |
| brivanib alaninate (CHEBI:167656) is a aromatic ether (CHEBI:35618) |
| brivanib alaninate (CHEBI:167656) is a carboxylic ester (CHEBI:33308) |
| brivanib alaninate (CHEBI:167656) is a diether (CHEBI:46786) |
| brivanib alaninate (CHEBI:167656) is a fluoroindole (CHEBI:131960) |
| brivanib alaninate (CHEBI:167656) is a pyrrolotriazine (CHEBI:88341) |
| IUPAC Name |
|---|
| (2R)-1-({4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl}oxy)propan-2-yl L-alaninate |
| INNs | Source |
|---|---|
| brivanib alaninate | WHO MedNet |
| alaninato de brivanib | WHO MedNet |
| alaninati brivanibum | WHO MedNet |
| alaninate de brivanib | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2R)-1-({4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl}oxy)propan-2-yl (2S)-2-aminopropanoate | IUPAC |
| BMS-582664 | ChemIDplus |
| BMS 582664 | ChemIDplus |
| BMS582664 | ChemIDplus |
| (1R,2S)-2-aminopropionic acid 2-[4-(4-fluoro-2-methyl-1H-indol-5-yloxy)-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yloxy]-1-methylethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB11865 | DrugBank |
| D08878 | KEGG DRUG |
| Brivanib_alaninate | Wikipedia |
| 9330033 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:649735-63-7 | ChemIDplus |
| Citations |
|---|