EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H33N5O3 |
| Net Charge | 0 |
| Average Mass | 535.648 |
| Monoisotopic Mass | 535.25834 |
| SMILES | CN1CCN(C(=O)c2cn(Cc3cncn3CC3=CC4OCOC4C=C3)cc2-c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C32H33N5O3/c1-34-11-13-36(14-12-34)32(38)29-20-35(19-28(29)27-8-4-6-24-5-2-3-7-26(24)27)18-25-16-33-21-37(25)17-23-9-10-30-31(15-23)40-22-39-30/h2-10,15-16,19-21,30-31H,11-14,17-18,22H2,1H3 |
| InChIKey | VZWZHIJGBPHRDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LB42908 (CHEBI:167660) has role antineoplastic agent (CHEBI:35610) |
| LB42908 (CHEBI:167660) has role apoptosis inducer (CHEBI:68495) |
| LB42908 (CHEBI:167660) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| LB42908 (CHEBI:167660) is a N-acylpiperazine (CHEBI:46844) |
| LB42908 (CHEBI:167660) is a N-methylpiperazine (CHEBI:46920) |
| LB42908 (CHEBI:167660) is a benzodioxole (CHEBI:38733) |
| LB42908 (CHEBI:167660) is a imidazoles (CHEBI:24780) |
| LB42908 (CHEBI:167660) is a naphthalenes (CHEBI:25477) |
| LB42908 (CHEBI:167660) is a pyrrolecarboxamide (CHEBI:48611) |
| IUPAC Name |
|---|
| [1-{[1-(3a,7a-dihydro-1,3-benzodioxol-5-ylmethyl)-1H-imidazol-5-yl]methyl}-4-(naphthalen-1-yl)-1H-pyrrol-3-yl](4-methylpiperazin-1-yl)methanone |
| Synonyms | Source |
|---|---|
| [1-[[3-(3a,7a-dihydro-1,3-benzodioxol-5-ylmethyl)imidazol-4-yl]methyl]-4-naphthalen-1-ylpyrrol-3-yl]-(4-methylpiperazin-1-yl)methanone | ChEBI |
| LB-42908 | ChEBI |
| LB 42908 | ChEBI |
| (1-((1-(benzo[d][1,3]dioxol-5-ylmethyl)-1H-imidazol-5-yl)methyl)-4-(naphthalen-1-yl)-1H-pyrrol-3-yl)(4-methylpiperazin-1-yl)methanone | ChEBI |
| [1-{[1-(1,3-benzodioxol-5-ylmethyl)-1H-imidazol-5-yl]-methyl}-4-(1-naphtyl)-1H-pyrrol-3-yl](4-methyl-1-piperazynyl)methanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 34980887 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:226927-89-5 | ChEBI |
| Citations |
|---|