EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33Cl2N3O5 |
| Net Charge | +2 |
| Average Mass | 526.461 |
| Monoisotopic Mass | 525.17863 |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(Cl)c(OCC[NH+]2CC[NH+](C)CC2)c(Cl)c1O |
| InChI | InChI=1S/C25H31Cl2N3O5/c1-3-34-25(33)20(15-17-7-5-4-6-8-17)28-24(32)18-16-19(26)23(21(27)22(18)31)35-14-13-30-11-9-29(2)10-12-30/h4-8,16,20,31H,3,9-15H2,1-2H3,(H,28,32)/p+2/t20-/m0/s1 |
| InChIKey | IPSSXIMJJXSJQB-FQEVSTJZSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JTE-607(2+) (CHEBI:167632) is a ammonium ion derivative (CHEBI:35274) |
| JTE-607(2+) (CHEBI:167632) is a organic cation (CHEBI:25697) |
| JTE-607(2+) (CHEBI:167632) is conjugate acid of JTE-607 free base (CHEBI:167630) |
| Incoming Relation(s) |
| JTE-607 dihydrochloride (CHEBI:167629) has part JTE-607(2+) (CHEBI:167632) |
| JTE-607 free base (CHEBI:167630) is conjugate base of JTE-607(2+) (CHEBI:167632) |
| IUPAC Name |
|---|
| ethyl N-{3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazinediium-1-yl)ethoxy]benzoyl}-L-phenylalaninate |
| Synonyms | Source |
|---|---|
| 1-[2-(2,6-dichloro-4-{[(2S)-1-ethoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}-3-hydroxyphenoxy)ethyl]-4-methylpiperazinediium | IUPAC |
| JTE-607 dication | ChEBI |