EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31Cl2N3O5.2HCl |
| Net Charge | 0 |
| Average Mass | 597.367 |
| Monoisotopic Mass | 595.11743 |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(Cl)c(OCCN2CCN(C)CC2)c(Cl)c1O.Cl.Cl |
| InChI | InChI=1S/C25H31Cl2N3O5.2ClH/c1-3-34-25(33)20(15-17-7-5-4-6-8-17)28-24(32)18-16-19(26)23(21(27)22(18)31)35-14-13-30-11-9-29(2)10-12-30;;/h4-8,16,20,31H,3,9-15H2,1-2H3,(H,28,32);2*1H/t20-;;/m0../s1 |
| InChIKey | JUJAUEQJEWIWCQ-FJSYBICCSA-N |
| Roles Classification |
|---|
| Biological Roles: | CPSF3 inhibitor Any inhibitor which inhibits the activity of cleavage and polyadenylation specificity factor subunit 3 protein (CPSF3). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JTE-607 dihydrochloride (CHEBI:167629) has part JTE-607(2+) (CHEBI:167632) |
| JTE-607 dihydrochloride (CHEBI:167629) has role anti-inflammatory agent (CHEBI:67079) |
| JTE-607 dihydrochloride (CHEBI:167629) has role antineoplastic agent (CHEBI:35610) |
| JTE-607 dihydrochloride (CHEBI:167629) has role apoptosis inducer (CHEBI:68495) |
| JTE-607 dihydrochloride (CHEBI:167629) has role cardioprotective agent (CHEBI:77307) |
| JTE-607 dihydrochloride (CHEBI:167629) has role CPSF3 inhibitor (CHEBI:167633) |
| JTE-607 dihydrochloride (CHEBI:167629) has role prodrug (CHEBI:50266) |
| JTE-607 dihydrochloride (CHEBI:167629) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| ethyl N-{3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl}-L-phenylalaninate dihydrochloride |
| Synonyms | Source |
|---|---|
| N-[3,5-dichloro-2-hydroxy-4-[2-(4-methyl-1-piperazinyl)ethoxy]benzoyl]-L-phenylalanine ethyl ester dihydrochloride | ChEBI |
| ethyl (2S)-2-{3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzamido}-3-phenylpropanoate dihydrochloride | IUPAC |
| (−)-ethyl-N-[3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]-L-phenylalaninate dihydrochloride | ChEBI |
| JTE 607 | ChemIDplus |
| JTE-607 | ChemIDplus |
| JTE-607 .2HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:188791-09-5 | ChemIDplus |
| Citations |
|---|