EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O2 |
| Net Charge | 0 |
| Average Mass | 160.172 |
| Monoisotopic Mass | 160.05243 |
| SMILES | Oc1cccc2cccc(O)c12 |
| InChI | InChI=1S/C10H8O2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H |
| InChIKey | OENHRRVNRZBNNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daldinia concentrica (ncbitaxon:42361) | - | DOI (10.1039/JR9600000654) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene-1,8-diol (CHEBI:167604) has role fungal metabolite (CHEBI:76946) |
| naphthalene-1,8-diol (CHEBI:167604) is a naphthalenediol (CHEBI:38133) |
| Incoming Relation(s) |
| 1,8-dihydroxynaphthalene-melanin (CHEBI:167605) has functional parent naphthalene-1,8-diol (CHEBI:167604) |
| IUPAC Name |
|---|
| naphthalene-1,8-diol |
| Synonyms | Source |
|---|---|
| 1,8-DHN | ChEBI |
| 1,8-dihydroxynaphthalene | ChemIDplus |
| 1,8-naphthalenediol | ChEBI |
| Citations |
|---|