EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O3 |
| Net Charge | 0 |
| Average Mass | 334.500 |
| Monoisotopic Mass | 334.25079 |
| SMILES | C/C=C(\C)CCCCCCC/C=C\C=C\C=C/C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C21H34O3/c1-3-19(2)16-14-12-10-8-6-4-5-7-9-11-13-15-17-20(22)18-21(23)24/h3,5,7,9,11,13,15,20,22H,4,6,8,10,12,14,16-18H2,1-2H3,(H,23,24)/b7-5-,11-9+,15-13-,19-3+/t20-/m1/s1 |
| InChIKey | FPUNLEAKMBDJNH-ZVJVAIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium soppii (ncbitaxon:69789) | - | PubMed (31086874) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soppiline A (CHEBI:167562) has role Penicillium metabolite (CHEBI:76964) |
| soppiline A (CHEBI:167562) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| soppiline A (CHEBI:167562) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| soppiline A (CHEBI:167562) is a long-chain fatty acid (CHEBI:15904) |
| soppiline A (CHEBI:167562) is conjugate acid of soppiline A(1−) (CHEBI:167558) |
| Incoming Relation(s) |
| soppiline A(1−) (CHEBI:167558) is conjugate base of soppiline A (CHEBI:167562) |
| IUPAC Name |
|---|
| (3R,5Z,7E,9Z,18E)-3-hydroxy-18-methylicosa-5,7,9,18-tetraenoic acid |
| Citations |
|---|