EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33O3 |
| Net Charge | -1 |
| Average Mass | 333.492 |
| Monoisotopic Mass | 333.24352 |
| SMILES | C/C=C(\C)CCCCCCC/C=C\C=C\C=C/C[C@@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C21H34O3/c1-3-19(2)16-14-12-10-8-6-4-5-7-9-11-13-15-17-20(22)18-21(23)24/h3,5,7,9,11,13,15,20,22H,4,6,8,10,12,14,16-18H2,1-2H3,(H,23,24)/p-1/b7-5-,11-9+,15-13-,19-3+/t20-/m1/s1 |
| InChIKey | FPUNLEAKMBDJNH-ZVJVAIEISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soppiline A(1−) (CHEBI:167558) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| soppiline A(1−) (CHEBI:167558) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| soppiline A(1−) (CHEBI:167558) is a long-chain fatty acid anion (CHEBI:57560) |
| soppiline A(1−) (CHEBI:167558) is conjugate base of soppiline A (CHEBI:167562) |
| Incoming Relation(s) |
| soppiline A (CHEBI:167562) is conjugate acid of soppiline A(1−) (CHEBI:167558) |
| IUPAC Name |
|---|
| (3R,5Z,7E,9Z,18E)-3-hydroxy-18-methylicosa-5,7,9,18-tetraenoate |
| Synonym | Source |
|---|---|
| soppiline A anion | ChEBI |
| UniProt Name | Source |
|---|---|
| soppiline A | UniProt |
| Citations |
|---|