EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O2 |
| Net Charge | 0 |
| Average Mass | 346.430 |
| Monoisotopic Mass | 346.16813 |
| SMILES | CC(=O)Nc1ccc(C)c(C(=O)N[C@H](C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-14-11-12-18(24-16(3)25)13-21(14)22(26)23-15(2)19-10-6-8-17-7-4-5-9-20(17)19/h4-13,15H,1-3H3,(H,23,26)(H,24,25)/t15-/m1/s1 |
| InChIKey | KGPYBLOBHQLIET-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KOM70144 (CHEBI:167314) has functional parent GRL-0617 (CHEBI:167176) |
| KOM70144 (CHEBI:167314) has role anticoronaviral agent (CHEBI:149553) |
| KOM70144 (CHEBI:167314) has role protease inhibitor (CHEBI:37670) |
| KOM70144 (CHEBI:167314) is a acetamides (CHEBI:22160) |
| KOM70144 (CHEBI:167314) is a benzamides (CHEBI:22702) |
| KOM70144 (CHEBI:167314) is a naphthalenes (CHEBI:25477) |
| KOM70144 (CHEBI:167314) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 5-acetamido-2-methyl-N-[(1R)-1-(naphthalen-1-yl)ethyl]benzamide |
| Synonyms | Source |
|---|---|
| 5-(acetylamino)-2-methyl-N-[(1R)-1-(1-naphthalenyl)ethyl]benzamide | ChEBI |
| (R)-5-acetamido-2-methyl-N-(1-(naphthalen-1-yl)ethyl)benzamide | ChEBI |
| 5-N-acetylamino-2-methyl-N-[(R)-1-(1-naphthyl)ethyl]benzamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1093070-14-4 | ChEBI |
| Citations |
|---|