EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O |
| Net Charge | 0 |
| Average Mass | 304.393 |
| Monoisotopic Mass | 304.15756 |
| SMILES | Cc1ccc(N)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H20N2O/c1-13-10-11-16(21)12-19(13)20(23)22-14(2)17-9-5-7-15-6-3-4-8-18(15)17/h3-12,14H,21H2,1-2H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | UVERBUNNCOKGNZ-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GRL-0617 (CHEBI:167176) has role anticoronaviral agent (CHEBI:149553) |
| GRL-0617 (CHEBI:167176) has role protease inhibitor (CHEBI:37670) |
| GRL-0617 (CHEBI:167176) is a benzamides (CHEBI:22702) |
| GRL-0617 (CHEBI:167176) is a naphthalenes (CHEBI:25477) |
| GRL-0617 (CHEBI:167176) is a secondary carboxamide (CHEBI:140325) |
| GRL-0617 (CHEBI:167176) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| KOM70144 (CHEBI:167314) has functional parent GRL-0617 (CHEBI:167176) |
| IUPAC Name |
|---|
| 5-amino-2-methyl-N-[(1R)-1-(naphthalen-1-yl)ethyl]benzamide |
| Synonyms | Source |
|---|---|
| 5-amino-2-methyl-N-[(1R)-1-(1-naphthalenyl)ethyl]benzamide | ChEBI |
| 5-amino-2-methyl-N-[(R)-1-(1-naphthyl)ethyl]benzamide | ChEBI |
| GRL 0617 | ChEBI |
| GRL0617 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| TTT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1093070-16-6 | ChEBI |
| Citations |
|---|