EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClFN3O3 |
| Net Charge | 0 |
| Average Mass | 421.900 |
| Monoisotopic Mass | 421.15685 |
| SMILES | [H][C@@]1(CNC(=O)c2cc(Cl)c(N)cc2OCC)CN(Cc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C21H25ClFN3O3/c1-2-28-20-10-19(24)18(22)9-17(20)21(27)25-11-16-13-26(7-8-29-16)12-14-3-5-15(23)6-4-14/h3-6,9-10,16H,2,7-8,11-13,24H2,1H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | YPELFRMCRYSPKZ-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-mosapride (CHEBI:167205) is a 4-amino-5-chloro-2-ethoxy-N-({4-[(4-fluorophenyl)methyl]morpholin-2-yl}methyl)benzamide (CHEBI:167204) |
| (R)-mosapride (CHEBI:167205) is enantiomer of (S)-mosapride (CHEBI:167206) |
| Incoming Relation(s) |
| mosapride (CHEBI:94373) has part (R)-mosapride (CHEBI:167205) |
| (S)-mosapride (CHEBI:167206) is enantiomer of (R)-mosapride (CHEBI:167205) |
| IUPAC Name |
|---|
| 4-amino-5-chloro-2-ethoxy-N-{[(2R)-4-(4-fluorobenzyl)morpholin-2-yl]methyl}benzamide |
| Registry Numbers | Sources |
|---|---|
| CAS:156925-24-5 | ChemIDplus |