EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O9P |
| Net Charge | -3 |
| Average Mass | 253.079 |
| Monoisotopic Mass | 252.97659 |
| SMILES | [H][C@]1([C@@H](O)CO)OC(=O)C(OP(=O)([O-])[O-])=C1[O-] |
| InChI | InChI=1S/C6H9O9P/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4,7-9H,1H2,(H2,11,12,13)/p-3/t2-,4+/m0/s1 |
| InChIKey | MIJPAVRNWPDMOR-ZAFYKAAXSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ascorbate 2-phosphate(3−) (CHEBI:167163) is a carbohydrate acid derivative anion (CHEBI:63551) |
| L-ascorbate 2-phosphate(3−) (CHEBI:167163) is a organophosphate oxoanion (CHEBI:58945) |
| L-ascorbate 2-phosphate(3−) (CHEBI:167163) is conjugate base of L-ascorbic acid 2-phosphate (CHEBI:167162) |
| Incoming Relation(s) |
| sodium L-ascorbic acid 2-phosphate (CHEBI:81687) has part L-ascorbate 2-phosphate(3−) (CHEBI:167163) |
| L-ascorbic acid 2-phosphate (CHEBI:167162) is conjugate acid of L-ascorbate 2-phosphate(3−) (CHEBI:167163) |
| IUPAC Name |
|---|
| (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-oxido-2-oxo-2,5-dihydrofuran-3-yl phosphate |
| Synonym | Source |
|---|---|
| 2-phospho-L-ascorbate | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| 2-PHOSPHOASCORBATE | MetaCyc |