EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O9P |
| Net Charge | 0 |
| Average Mass | 256.103 |
| Monoisotopic Mass | 255.99842 |
| SMILES | [H][C@]1([C@@H](O)CO)OC(=O)C(OP(=O)(O)O)=C1O |
| InChI | InChI=1S/C6H9O9P/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4,7-9H,1H2,(H2,11,12,13)/t2-,4+/m0/s1 |
| InChIKey | MIJPAVRNWPDMOR-ZAFYKAAXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ascorbic acid 2-phosphate (CHEBI:167162) has functional parent L-ascorbic acid (CHEBI:29073) |
| L-ascorbic acid 2-phosphate (CHEBI:167162) is a aldonolactone phosphate (CHEBI:37429) |
| L-ascorbic acid 2-phosphate (CHEBI:167162) is conjugate acid of L-ascorbate 2-phosphate(3−) (CHEBI:167163) |
| Incoming Relation(s) |
| L-ascorbate 2-phosphate(3−) (CHEBI:167163) is conjugate base of L-ascorbic acid 2-phosphate (CHEBI:167162) |
| IUPAC Name |
|---|
| (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-2-oxo-2,5-dihydrofuran-3-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 2-O-phosphono-L-ascorbic acid | ChEBI |
| 2-phospho-L-ascorbic acid | ChEBI |
| ascorbate-2-phosphate | ChemIDplus |
| ascorbyl-2-monophosphate | ChemIDplus |
| ascorbyl-2-phosphate | ChemIDplus |
| L-ascorbic acid 2-(dihydrogen phosphate) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:23313-12-4 | ChemIDplus |
| Citations |
|---|