EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27ClN2O5 |
| Net Charge | 0 |
| Average Mass | 422.909 |
| Monoisotopic Mass | 422.16085 |
| SMILES | CCOC(=O)OC1=C(c2c(C)cc(Cl)cc2C)C(=O)N(C)C12CCN(OC)CC2 |
| InChI | InChI=1S/C21H27ClN2O5/c1-6-28-20(26)29-18-17(16-13(2)11-15(22)12-14(16)3)19(25)23(4)21(18)7-9-24(27-5)10-8-21/h11-12H,6-10H2,1-5H3 |
| InChIKey | WOPFPAIGRGHWAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiropidion (CHEBI:167159) has role agrochemical (CHEBI:33286) |
| spiropidion (CHEBI:167159) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| spiropidion (CHEBI:167159) has role proinsecticide (CHEBI:136644) |
| spiropidion (CHEBI:167159) is a azaspiro compound (CHEBI:35624) |
| spiropidion (CHEBI:167159) is a carbonate ester (CHEBI:46722) |
| spiropidion (CHEBI:167159) is a monochlorobenzenes (CHEBI:83403) |
| spiropidion (CHEBI:167159) is a tetramic acids (CHEBI:140155) |
| IUPAC Name |
|---|
| 3-(4-chloro-2,6-dimethylphenyl)-8-methoxy-1-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl ethyl carbonate |
| Synonyms | Source |
|---|---|
| 3-(4-chloro-2,6-xylyl)-8-methoxy-1-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl ethyl carbonate | Alan Wood's Pesticides |
| SYN546330 | PPDB |
| Brand Name | Source |
|---|---|
| Elestal | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3189 | PPDB |
| 59651409 | ChemSpider |
| spiropidion | Alan Wood's Pesticides |
| WO2010066780 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1229023-00-0 | ChemIDplus |
| Citations |
|---|