EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:167053 - D-alanylgriseoluteic acid zwitterion
| Formula | C18H17N3O5 |
| Net Charge | 0 |
| Average Mass | 355.350 |
| Monoisotopic Mass | 355.11682 |
| SMILES | COc1ccc(COC(=O)C(C)[NH3+])c2nc3cccc(C(=O)[O-])c3nc12 |
| InChI | InChI=1S/C18H17N3O5/c1-9(19)18(24)26-8-10-6-7-13(25-2)16-14(10)20-12-5-3-4-11(17(22)23)15(12)21-16/h3-7,9H,8,19H2,1-2H3,(H,22,23) |
| InChIKey | YKZUYEOZKPPQGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-alanylgriseoluteic acid zwitterion (CHEBI:167053) has role antimicrobial agent (CHEBI:33281) |
| D-alanylgriseoluteic acid zwitterion (CHEBI:167053) is a amino-acid zwitterion (CHEBI:35238) |
| D-alanylgriseoluteic acid zwitterion (CHEBI:167053) is a phenazines (CHEBI:39201) |
| UniProt Name | Source |
|---|---|
| D-alanylgriseoluteate | UniProt |
| Citations |
|---|