EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O |
| Net Charge | 0 |
| Average Mass | 134.178 |
| Monoisotopic Mass | 134.07316 |
| SMILES | OC1CCc2ccccc21 |
| InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 |
| InChIKey | YIAPLDFPUUJILH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indan-1-ol (CHEBI:16697) has parent hydride indane (CHEBI:37911) |
| indan-1-ol (CHEBI:16697) has role xenobiotic (CHEBI:35703) |
| indan-1-ol (CHEBI:16697) is a aromatic alcohol (CHEBI:33854) |
| indan-1-ol (CHEBI:16697) is a indanes (CHEBI:46940) |
| indan-1-ol (CHEBI:16697) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| (S)-(+)-1-indanol (CHEBI:156384) is a indan-1-ol (CHEBI:16697) |
| IUPAC Name |
|---|
| 2,3-dihydro-1H-inden-1-ol |
| Synonyms | Source |
|---|---|
| 1-hydroxyhydrindene | NIST Chemistry WebBook |
| 1-indanol | ChemIDplus |
| Indan-1-ol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| indan-1-ol | UniProt |