EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O |
| Net Charge | 0 |
| Average Mass | 134.178 |
| Monoisotopic Mass | 134.07316 |
| SMILES | O[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2/t9-/m0/s1 |
| InChIKey | YIAPLDFPUUJILH-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(+)-1-indanol (CHEBI:156384) is a indan-1-ol (CHEBI:16697) |
| IUPAC Name |
|---|
| (1S)-indan-1-ol |
| Synonym | Source |
|---|---|
| (S)-(+)-1-hydroxyindan | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (S)-indan-1-ol | UniProt |
| Citations |
|---|