EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N2O |
| Net Charge | +1 |
| Average Mass | 191.254 |
| Monoisotopic Mass | 191.11789 |
| SMILES | COc1ccc2ncc(CC[NH3+])c2c1 |
| InChI | InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3/p+1 |
| InChIKey | JTEJPPKMYBDEMY-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxytryptamine(1+) (CHEBI:166874) is a primary ammonium ion (CHEBI:65296) |
| 5-methoxytryptamine(1+) (CHEBI:166874) is conjugate acid of 5-methoxytryptamine (CHEBI:2089) |
| Incoming Relation(s) |
| 5-methoxytryptamine (CHEBI:2089) is conjugate base of 5-methoxytryptamine(1+) (CHEBI:166874) |
| IUPAC Name |
|---|
| 2-(5-methoxy-1H-indol-3-yl)ethanaminium |
| Synonyms | Source |
|---|---|
| 5-methoxytryptamine cation | ChEBI |
| 5-methoxytryptaminium | ChEBI |
| O-methylserotonin(1+) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 5-methoxytryptamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12018 | MetaCyc |