EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6N2O3 |
| Net Charge | 0 |
| Average Mass | 106.081 |
| Monoisotopic Mass | 106.03784 |
| SMILES | NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N2O3/c3-1-2-7-4(5)6/h1-3H2 |
| InChIKey | KZTZJUQNSSLNAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminoethyl nitrate (CHEBI:166870) has functional parent ethanolamine (CHEBI:16000) |
| aminoethyl nitrate (CHEBI:166870) has role vasodilator agent (CHEBI:35620) |
| aminoethyl nitrate (CHEBI:166870) is a nitrate ester (CHEBI:51080) |
| aminoethyl nitrate (CHEBI:166870) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| itramin tosilate (CHEBI:136001) has part aminoethyl nitrate (CHEBI:166870) |
| IUPAC Name |
|---|
| 2-aminoethyl nitrate |
| INNs | Source |
|---|---|
| aminoethyl nitrate | WHO MedNet |
| aminoethylis nitras | WHO MedNet |
| nitrato de aminoetilo | WHO MedNet |
| nitrate d'aminoéthyle | WHO MedNet |
| Synonyms | Source |
|---|---|
| itramin | DrugBank |
| 2-nitratoethylamine | ChEBI |
| 2-aminoethanol nitrate ester | ChEBI |
| nitrolamine | ChemIDplus |
| monoethanolamine nitrate ester | ChEBI |
| CLC-1011 | ChEBI |
| Brand Name | Source |
|---|---|
| Aramin | ChemIDplus |
| Citations |
|---|