EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6N2O3.C7H8O3S |
| Net Charge | 0 |
| Average Mass | 278.286 |
| Monoisotopic Mass | 278.05726 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C7H8O3S.C2H6N2O3/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-7-4(5)6/h2-5H,1H3,(H,8,9,10);1-3H2 |
| InChIKey | HPPBBWMYZVALRK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| itramin tosilate (CHEBI:136001) has part aminoethyl nitrate (CHEBI:166870) |
| itramin tosilate (CHEBI:136001) has role vasodilator agent (CHEBI:35620) |
| itramin tosilate (CHEBI:136001) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| 2-aminoethyl nitrate 4-methylbenzenesulfonate |
| INNs | Source |
|---|---|
| itramini tosilas | WHO MedNet |
| tosilato de itramina | WHO MedNet |
| tosilate d'itramine | WHO MedNet |
| Synonyms | Source |
|---|---|
| itramin tosylate | DrugCentral |
| itramina tosilato | ChEBI |
| 2-aminoethanol nitrate mono-p-toluenesulfonate | ChEBI |
| 2-nitratoethylaminotoluene-p-sulfonate | ChEBI |
| 2-aminoethanol nitrate mono(4-methylbenzenesulfonate) | ChEBI |
| 4-methylbenzene-1-sulfonic acid—2-aminoethyl nitrate | IUPAC |
| Brand Names | Source |
|---|---|
| itramin tosilate | WHO MedNet |
| Tostramin | ChemIDplus |
| Tostram | ChemIDplus |
| Cardisan | ChemIDplus |
| Nilatil | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4583 | DrugCentral |
| DBSALT002523 | DrugBank |
| D07157 | KEGG DRUG |
| Itramin_tosilate | Wikipedia |
| 24219 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13445-63-1 | ChemIDplus |
| Citations |
|---|