EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H2Cl3O2 |
| Net Charge | -1 |
| Average Mass | 224.450 |
| Monoisotopic Mass | 222.91259 |
| SMILES | O=C([O-])c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12)/p-1 |
| InChIKey | CGFDSIZRJWMQPP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-trichlorobenzoate (CHEBI:166859) is a chlorobenzoate (CHEBI:23133) |
| 2,3,5-trichlorobenzoate (CHEBI:166859) is conjugate base of 2,3,5-trichlorobenzoic acid (CHEBI:166848) |
| Incoming Relation(s) |
| 2,3,5-trichlorobenzoic acid (CHEBI:166848) is conjugate acid of 2,3,5-trichlorobenzoate (CHEBI:166859) |
| IUPAC Name |
|---|
| 2,3,5-trichlorobenzoate |
| Synonym | Source |
|---|---|
| 2,3,5-trichlorobenzoic acid anion | ChEBI |
| Citations |
|---|