EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl3O2 |
| Net Charge | 0 |
| Average Mass | 225.458 |
| Monoisotopic Mass | 223.91986 |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) |
| InChIKey | CGFDSIZRJWMQPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-trichlorobenzoic acid (CHEBI:166848) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,3,5-trichlorobenzoic acid (CHEBI:166848) is a chlorobenzoic acid (CHEBI:23134) |
| 2,3,5-trichlorobenzoic acid (CHEBI:166848) is a trichlorobenzene (CHEBI:27096) |
| 2,3,5-trichlorobenzoic acid (CHEBI:166848) is conjugate acid of 2,3,5-trichlorobenzoate (CHEBI:166859) |
| Incoming Relation(s) |
| 2,3,5-trichlorobenzoate (CHEBI:166859) is conjugate base of 2,3,5-trichlorobenzoic acid (CHEBI:166848) |
| IUPAC Name |
|---|
| 2,3,5-trichlorobenzoic acid |
| Synonym | Source |
|---|---|
| benzoic acid, 2,3,5-trichloro- | ChemIDplus |
| Citations |
|---|