EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H28N2 |
| Net Charge | +2 |
| Average Mass | 188.359 |
| Monoisotopic Mass | 188.22415 |
| SMILES | C[N+](C)(C)CCCCC[N+](C)(C)C |
| InChI | InChI=1S/C11H28N2/c1-12(2,3)10-8-7-9-11-13(4,5)6/h7-11H2,1-6H3/q+2 |
| InChIKey | XUSPWDAHGXSTHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentamethonium (CHEBI:166825) has functional parent cadaverine (CHEBI:18127) |
| pentamethonium (CHEBI:166825) has role antihypertensive agent (CHEBI:35674) |
| pentamethonium (CHEBI:166825) has role vasodilator agent (CHEBI:35620) |
| pentamethonium (CHEBI:166825) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| pentamethonium bromide (CHEBI:134839) has part pentamethonium (CHEBI:166825) |
| IUPAC Name |
|---|
| N,N,N,N',N',N'-hexamethylpentane-1,5-bis(aminium) |
| Synonyms | Source |
|---|---|
| N1,N1,N1,N5,N5,N5-hexamethylpentane-1,5-bis(aminium) | IUPAC |
| pentamethonum | ChemIDplus |
| N,N,N,N',N',N'-hexamethyl-1,5-pentanediaminium | ChemIDplus |
| 1,5-pentanediylbis(trimethylaminium) | ChEBI |
| trimethyl-[5-(trimethylazaniumyl)pentyl]azanium | ChEBI |
| Citations |
|---|