EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2Br.C11H28N2 |
| Net Charge | 0 |
| Average Mass | 348.167 |
| Monoisotopic Mass | 346.06192 |
| SMILES | C[N+](C)(C)CCCCC[N+](C)(C)C.[Br-].[Br-] |
| InChI | InChI=1S/C11H28N2.2BrH/c1-12(2,3)10-8-7-9-11-13(4,5)6;;/h7-11H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | GJVFBWCTGUSGDD-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentamethonium bromide (CHEBI:134839) has part pentamethonium (CHEBI:166825) |
| pentamethonium bromide (CHEBI:134839) has role antihypertensive agent (CHEBI:35674) |
| pentamethonium bromide (CHEBI:134839) has role vasodilator agent (CHEBI:35620) |
| pentamethonium bromide (CHEBI:134839) is a bromide salt (CHEBI:22925) |
| pentamethonium bromide (CHEBI:134839) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| N,N,N,N',N',N'-hexamethylpentane-1,5-bis(aminium) dibromide |
| INNs | Source |
|---|---|
| bromuro de pentametonio | WHO MedNet |
| bromure de pentaméthonium | WHO MedNet |
| pentamethonii bromidum | WHO MedNet |
| pentamethonium bromide | WHO MedNet |
| Synonyms | Source |
|---|---|
| α,ω-bis(trimethylammonium)pentane dibromide | ChemIDplus |
| pentamethonium dibromide | DrugCentral |
| N1,N1,N1,N5,N5,N5-hexamethylpentane-1,5-bis(aminium) dibromide | IUPAC |
| N,N,N,N',N',N'-hexamethyl-1,5-pentanediaminium dibromide | ChemIDplus |
| pentamethylenebis[trimethylammonium bromide] | ChEBI |
| 1,5-dibromohexamethylpentaneammonium | ChEBI |
| Brand Names | Source |
|---|---|
| Penthonium | ChemIDplus |
| Lytensium | ChemIDplus |
| Citations |
|---|