EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O2S |
| Net Charge | 0 |
| Average Mass | 243.332 |
| Monoisotopic Mass | 243.10415 |
| SMILES | [H][C@]12CS[C@@H](CCCCC(N)=O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C10H17N3O2S/c11-8(14)4-2-1-3-7-9-6(5-16-7)12-10(15)13-9/h6-7,9H,1-5H2,(H2,11,14)(H2,12,13,15)/t6-,7-,9-/m0/s1 |
| InChIKey | XFLVBMBRLSCJAI-ZKWXMUAHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biotin amide (CHEBI:16615) has functional parent biotin (CHEBI:15956) |
| biotin amide (CHEBI:16615) has role human metabolite (CHEBI:77746) |
| biotin amide (CHEBI:16615) is a biotins (CHEBI:51570) |
| biotin amide (CHEBI:16615) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanamide |
| Synonyms | Source |
|---|---|
| Biotin amide | KEGG COMPOUND |
| biotinamide | ChemIDplus |
| UniProt Name | Source |
|---|---|
| biotin amide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01893 | KEGG COMPOUND |
| CPD-574 | MetaCyc |
| HMDB0001458 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:86836 | Reaxys |
| CAS:6929-42-6 | ChemIDplus |
| CAS:6929-42-6 | KEGG COMPOUND |
| Citations |
|---|