EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O |
| Net Charge | 0 |
| Average Mass | 219.248 |
| Monoisotopic Mass | 219.11201 |
| SMILES | C/C(=C\CNc1ncnc2ncnc12)CO |
| InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ |
| InChIKey | UZKQTCBAMSWPJD-FARCUNLSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-zeatin (CHEBI:16522) has role plant metabolite (CHEBI:76924) |
| trans-zeatin (CHEBI:16522) is a zeatin (CHEBI:15333) |
| IUPAC Name |
|---|
| (2E)-2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-ol |
| Synonyms | Source |
|---|---|
| Zeatin | KEGG COMPOUND |
| N6-(4-Hydroxyisopentenyl)adenine | KEGG COMPOUND |
| (E)-2-Methyl-4-(1H-purin-6-ylamino)but-2-en-1-ol | KEGG COMPOUND |
| (E)-2-methyl-4-(1H-purin-6-ylamino)but-2-en-1-ol | IUBMB |
| (E)-zeatin | ChemIDplus |
| (E)-2-methyl-4-(purin-6-ylamino)-2-buten-1-ol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| trans-zeatin | UniProt |
| Citations |
|---|