EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O |
| Net Charge | 0 |
| Average Mass | 219.248 |
| Monoisotopic Mass | 219.11201 |
| SMILES | [H]C(CNc1ncnc2ncnc12)=C(C)CO |
| InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | UZKQTCBAMSWPJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeatin (CHEBI:15333) has role cytokinin (CHEBI:23530) |
| zeatin (CHEBI:15333) is a 6-isopentenylaminopurine (CHEBI:38643) |
| Incoming Relation(s) |
| N-glycosylzeatin (CHEBI:38645) has functional parent zeatin (CHEBI:15333) |
| O-β-D-glucosylzeatins (CHEBI:38644) has functional parent zeatin (CHEBI:15333) |
| O-β-D-xylosylzeatin (CHEBI:17438) has functional parent zeatin (CHEBI:15333) |
| 9-alanylzeatin (CHEBI:20820) has functional parent zeatin (CHEBI:15333) |
| cis-zeatin (CHEBI:46570) is a zeatin (CHEBI:15333) |
| trans-zeatin (CHEBI:16522) is a zeatin (CHEBI:15333) |
| IUPAC Name |
|---|
| 2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-ol |
| UniProt Name | Source |
|---|---|
| zeatin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1217241 | Beilstein |