EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CCC=C(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
| InChIKey | CAHGCLMLTWQZNJ-BQNIITSRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanosterol (CHEBI:16521) has parent hydride lanostane (CHEBI:20265) |
| lanosterol (CHEBI:16521) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| lanosterol (CHEBI:16521) has role bacterial metabolite (CHEBI:76969) |
| lanosterol (CHEBI:16521) has role human metabolite (CHEBI:77746) |
| lanosterol (CHEBI:16521) has role mouse metabolite (CHEBI:75771) |
| lanosterol (CHEBI:16521) has role plant metabolite (CHEBI:76924) |
| lanosterol (CHEBI:16521) is a 14α-methyl steroid (CHEBI:138029) |
| lanosterol (CHEBI:16521) is a 3β-sterol (CHEBI:35348) |
| lanosterol (CHEBI:16521) is a tetracyclic triterpenoid (CHEBI:26893) |
| Incoming Relation(s) |
| 14-demethyllanosterol (CHEBI:18364) has functional parent lanosterol (CHEBI:16521) |
| 24,25-dihydrolanosterol (CHEBI:28113) has functional parent lanosterol (CHEBI:16521) |
| 26-hydroxylanosterol (CHEBI:178023) has functional parent lanosterol (CHEBI:16521) |
| 26-oxolanosterol (CHEBI:178024) has functional parent lanosterol (CHEBI:16521) |
| 3β-hydroxy-lanosta-8, 24-dien-26-oate (CHEBI:178025) has functional parent lanosterol (CHEBI:16521) |
| lanosteryl ester (CHEBI:52394) has functional parent lanosterol (CHEBI:16521) |
| pneumocysterol (CHEBI:138589) has functional parent lanosterol (CHEBI:16521) |
| IUPAC Name |
|---|
| lanosta-8,24-dien-3β-ol |
| Synonyms | Source |
|---|---|
| (3β,5α)-4,4,14-trimethylcholesta-8,24-dien-3-ol | ChemIDplus |
| (3β)-lanosta-8,24-dien-3-ol | ChemIDplus |
| 4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol | KEGG COMPOUND |
| Lanosterin | HMDB |
| Lanosterol | KEGG COMPOUND |
| LANOSTEROL | PDBeChem |
| UniProt Name | Source |
|---|---|
| lanosterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003657 | KNApSAcK |
| C01724 | KEGG COMPOUND |
| DB03696 | DrugBank |
| HMDB0001251 | HMDB |
| LAN | PDBeChem |
| Lanosterol | Wikipedia |
| LANOSTEROL | MetaCyc |
| LMST01010017 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2226449 | Reaxys |
| CAS:79-63-0 | KEGG COMPOUND |
| CAS:79-63-0 | ChemIDplus |
| Citations |
|---|