EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O |
| Net Charge | 0 |
| Average Mass | 454.783 |
| Monoisotopic Mass | 454.41747 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CC/C(=C/C)C(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C32H54O/c1-10-23(21(2)3)12-11-22(4)24-15-19-32(9)26-13-14-27-29(5,6)28(33)17-18-30(27,7)25(26)16-20-31(24,32)8/h10,21-22,24,27-28,33H,11-20H2,1-9H3/b23-10-/t22-,24-,27+,28+,30-,31-,32+/m1/s1 |
| InChIKey | XCGCVXQNARNGON-RNBJSANHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pneumocystis carinii (ncbitaxon:4754) | - | PubMed (10548595) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pneumocysterol (CHEBI:138589) has functional parent lanosterol (CHEBI:16521) |
| pneumocysterol (CHEBI:138589) has role fungal metabolite (CHEBI:76946) |
| pneumocysterol (CHEBI:138589) is a 14α-methyl steroid (CHEBI:138029) |
| pneumocysterol (CHEBI:138589) is a 3β-sterol (CHEBI:35348) |
| pneumocysterol (CHEBI:138589) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Names |
|---|
| (24Z)-24-ethylidenelanost-8-en-3β-ol |
| (3β,24Z)-24-ethylidenelanost-8-en-3-ol |
| Synonym | Source |
|---|---|
| (Z)-24-ethylidenelanosterol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (24Z)-ethylidenelanosterol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5770733 | Reaxys |
| CAS:78821-76-8 | ChemIDplus |
| Citations |
|---|