EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:16460 - polyprenol phosphate
| Formula | (C5H8)n.C5H11O4P |
| Net Charge | 0 |
| Average Mass | 234.232 |
| Monoisotopic Mass | 234.10210 |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)(O)O |
| InChI | InChI=1S/C10H19O4P/c1-9(2)5-4-6-10(3)7-8-14-15(11,12)13/h5,7H,4,6,8H2,1-3H3,(H2,11,12,13)/b10-7+ |
| InChIKey | FFOWJDCTFSWUMJ-JXMROGBWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyprenol phosphate (CHEBI:16460) has functional parent polyprenol (CHEBI:26199) |
| polyprenol phosphate (CHEBI:16460) is a prenol phosphate (CHEBI:26250) |
| polyprenol phosphate (CHEBI:16460) is a terpenyl phosphate (CHEBI:26875) |
| polyprenol phosphate (CHEBI:16460) is conjugate acid of polyprenol phosphate anion (CHEBI:157763) |
| Incoming Relation(s) |
| ditrans,polycis-dodecaprenyl phosphate (CHEBI:142378) is a polyprenol phosphate (CHEBI:16460) |
| all-cis-polyprenol phosphate (CHEBI:70742) is a polyprenol phosphate (CHEBI:16460) |
| all-trans-polyprenol phosphate (CHEBI:70739) is a polyprenol phosphate (CHEBI:16460) |
| trans,polycis-decaprenyl phosphate (CHEBI:66867) is a polyprenol phosphate (CHEBI:16460) |
| decaprenol phosphate (CHEBI:16477) is a polyprenol phosphate (CHEBI:16460) |
| dolichyl-4-D-xylosyl phosphate (CHEBI:184200) is a polyprenol phosphate (CHEBI:16460) |
| farnesyl phosphate (CHEBI:24018) is a polyprenol phosphate (CHEBI:16460) |
| geranyl phosphate (CHEBI:90159) is a polyprenol phosphate (CHEBI:16460) |
| phytyl phosphate (CHEBI:75838) is a polyprenol phosphate (CHEBI:16460) |
| polyprenol triphosphate (CHEBI:26203) is a polyprenol phosphate (CHEBI:16460) |
| polyprenyl diphosphate (CHEBI:37531) is a polyprenol phosphate (CHEBI:16460) |
| polyprenyl phospho carbohydrate (CHEBI:26187) is a polyprenol phosphate (CHEBI:16460) |
| polyprenol phosphate anion (CHEBI:157763) is conjugate base of polyprenol phosphate (CHEBI:16460) |
| Synonyms | Source |
|---|---|
| polyprenol phosphates | ChEBI |
| Polyprenyl phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01048 | KEGG COMPOUND |