EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H8)n.C5H9O4P |
| Net Charge | -2 |
| Average Mass | 232.216 |
| Monoisotopic Mass | 232.08754 |
| SMILES | CC(C)=CCCC(C)=CCOP(=O)([O-])[O-] |
| InChI | InChI=1S/C10H19O4P/c1-9(2)5-4-6-10(3)7-8-14-15(11,12)13/h5,7H,4,6,8H2,1-3H3,(H2,11,12,13)/p-2 |
| InChIKey | FFOWJDCTFSWUMJ-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyprenol phosphate anion (CHEBI:157763) is a prenols (CHEBI:26244) |
| polyprenol phosphate anion (CHEBI:157763) is conjugate base of polyprenol phosphate (CHEBI:16460) |
| Incoming Relation(s) |
| all-trans-decaprenyl diphosphate(3−) (CHEBI:60721) is a polyprenol phosphate anion (CHEBI:157763) |
| undecaprenyl phosphate(2−) (CHEBI:57654) is a polyprenol phosphate anion (CHEBI:157763) |
| polyprenol phosphate (CHEBI:16460) is conjugate acid of polyprenol phosphate anion (CHEBI:157763) |
| UniProt Name | Source |
|---|---|
| a polyprenol phosphate | UniProt |