EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CNc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H9NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h2-5,9H,1H3,(H,10,11) |
| InChIKey | WVMBPWMAQDVZCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylanthranilic acid (CHEBI:16394) has functional parent anthranilic acid (CHEBI:30754) |
| N-methylanthranilic acid (CHEBI:16394) has role plant metabolite (CHEBI:76924) |
| N-methylanthranilic acid (CHEBI:16394) is a aromatic amino acid (CHEBI:33856) |
| N-methylanthranilic acid (CHEBI:16394) is conjugate acid of N-methylanthranilate (CHEBI:36557) |
| Incoming Relation(s) |
| N-methylanthraniloyl-CoA (CHEBI:30305) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| 2'-MANT-GDP (CHEBI:85432) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| 3'-O-(N-methylanthraniloyl)adenosine 5'-diphosphate (CHEBI:71336) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| 3'-MANT-GDP (CHEBI:85434) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| MANT-GDP (CHEBI:84677) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| methyl N-methylanthranilate (CHEBI:142267) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| N-methylanthranilate (CHEBI:36557) is conjugate base of N-methylanthranilic acid (CHEBI:16394) |
| IUPAC Name |
|---|
| 2-(methylamino)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-(Methylamino)benzoic acid | KEGG COMPOUND |
| N-Methyl-2-aminobenzoic acid | ChemIDplus |
| N-Methylanthranilic acid | KEGG COMPOUND |
| N-Methyl-o-aminobenzoic acid | ChemIDplus |
| o-(Methylamino)benzoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C03005 | KEGG COMPOUND |
| HMDB0032609 | HMDB |
| LSM-20003 | LINCS |
| Citations |
|---|