EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:142267 - methyl N-methylanthranilate
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | CNc1ccccc1C(=O)OC |
| InChI | InChI=1S/C9H11NO2/c1-10-8-6-4-3-5-7(8)9(11)12-2/h3-6,10H,1-2H3 |
| InChIKey | GVOWHGSUZUUUDR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zanthoxylum beecheyanum (ncbitaxon:1056465) | stem (BTO:0001300) | Article (Cheng, M.J., Wu, C.C., Tsai, I.L. and Chen, I.S. (2004) Chemical and antiplatelet constituents from the stem of Zanthoxylum beecheyanum. J. Chin. Chem. Soc., 51(5A), 1065-1072.) | |
| Murraya paniculata (ncbitaxon:43711) | bark (BTO:0001301) | Article (Imai, F., Itoh, K., Kishibuchi, N., Kinoshita, T. and Sankawa, U. (1989) Constituents of the root bark of Murraya paniculata collected in Indonesia. Chem. Pharm. Bull., 37(1), 119-123.) | Isolated from root bark |
| Citrus unshiu (ncbitaxon:55188) | - | Article (Kekelidze, N.A. and Dzhanikashvili, M.I. (1985) The essential oils of the fruits of early-ripening varieties of Citrus unshiu. Chem. Nat. Compd., 21(4), 540-541.) | |
| Monascus sp. (ncbitaxon:1963841) | - | Article (Cheng, M.J., Wu, M.D., Chen, I.S. and Yuan, G.F. (2011). Chemical constituents isolated from the fungus Monascus sp. Chem. Nat. Compd., 47(4), 566-570.) | |
| Typhloiulus orpheus (ncbitaxon:1522048) | whole organism (UBERON:0000468) | PubMed (28804216) | |
| Citrus reticulata (ncbitaxon:85571) | leaf (BTO:0000713) | PubMed (26471095) | |
| Citrus x paradisi (ncbitaxon:37656) | - | PubMed (16332132) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl N-methylanthranilate (CHEBI:142267) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| methyl N-methylanthranilate (CHEBI:142267) has role animal metabolite (CHEBI:75767) |
| methyl N-methylanthranilate (CHEBI:142267) has role fungal metabolite (CHEBI:76946) |
| methyl N-methylanthranilate (CHEBI:142267) has role plant metabolite (CHEBI:76924) |
| methyl N-methylanthranilate (CHEBI:142267) is a benzoate ester (CHEBI:36054) |
| methyl N-methylanthranilate (CHEBI:142267) is a methyl ester (CHEBI:25248) |
| methyl N-methylanthranilate (CHEBI:142267) is a secondary amino compound (CHEBI:50995) |
| methyl N-methylanthranilate (CHEBI:142267) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| methyl 2-(methylamino)benzoate |
| Synonyms | Source |
|---|---|
| methyl N-methyl anthranylate | ChEBI |
| N-methylanthranilic acid, methyl ester | HMDB |
| methyl methanthranilate | HMDB |
| methyl methylanthranilate | HMDB |
| methyl methylaminobenzoate | HMDB |
| dimethyl anthranilate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034169 | HMDB |
| FDB012455 | FooDB |
| EP0190667 | Patent |
| Citations |
|---|