EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8N2O2 |
| Net Charge | 0 |
| Average Mass | 104.109 |
| Monoisotopic Mass | 104.05858 |
| SMILES | NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m0/s1 |
| InChIKey | PECYZEOJVXMISF-REOHCLBHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-L-alanine (CHEBI:16303) is a L-alanine derivative (CHEBI:83943) |
| 3-amino-L-alanine (CHEBI:16303) is a 3-aminoalanine (CHEBI:18383) |
| 3-amino-L-alanine (CHEBI:16303) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-amino-L-alanine (CHEBI:16303) is conjugate acid of 3-amino-L-alaninate (CHEBI:13043) |
| 3-amino-L-alanine (CHEBI:16303) is conjugate base of 3-ammonio-L-alanine (CHEBI:42164) |
| 3-amino-L-alanine (CHEBI:16303) is conjugate base of 3-ammonio-L-alanine(1+) (CHEBI:84374) |
| 3-amino-L-alanine (CHEBI:16303) is enantiomer of 3-amino-D-alanine (CHEBI:136598) |
| 3-amino-L-alanine (CHEBI:16303) is tautomer of 3-amino-L-alanine zwitterion (CHEBI:57721) |
| Incoming Relation(s) |
| N(3)-(4-methoxyfumaroyl)-2,3-diaminopropionic acid (CHEBI:74407) has functional parent 3-amino-L-alanine (CHEBI:16303) |
| N3-fumaramoyl-(S)-2,3-diaminopropanoic acid (CHEBI:85347) has functional parent 3-amino-L-alanine (CHEBI:16303) |
| N3-fumaroyl-(S)-2,3-diaminopropanoic acid (CHEBI:85346) has functional parent 3-amino-L-alanine (CHEBI:16303) |
| 2-[(L-alanin-3-ylcarbamoyl)methyl]-2-hydroxybutanedioate(2−) (CHEBI:142969) has functional parent 3-amino-L-alanine (CHEBI:16303) |
| 3-amino-N-(trans-3-carbamoyloxirane-2-carbonyl)-L-alanine (CHEBI:85509) has functional parent 3-amino-L-alanine (CHEBI:16303) |
| dapdiamide (CHEBI:85331) has functional parent 3-amino-L-alanine (CHEBI:16303) |
| 3-ammonio-L-alanine (CHEBI:42164) is conjugate acid of 3-amino-L-alanine (CHEBI:16303) |
| 3-ammonio-L-alanine(1+) (CHEBI:84374) is conjugate acid of 3-amino-L-alanine (CHEBI:16303) |
| 3-amino-L-alaninate (CHEBI:13043) is conjugate base of 3-amino-L-alanine (CHEBI:16303) |
| 3-amino-D-alanine (CHEBI:136598) is enantiomer of 3-amino-L-alanine (CHEBI:16303) |
| 3-amino-L-alanine residue (CHEBI:42155) is substituent group from 3-amino-L-alanine (CHEBI:16303) |
| 3-amino-L-alanine zwitterion (CHEBI:57721) is tautomer of 3-amino-L-alanine (CHEBI:16303) |
| IUPAC Names |
|---|
| (2S)-2,3-diaminopropanoic acid |
| 3-amino-L-alanine |
| Synonyms | Source |
|---|---|
| Dpr | ChEBI |
| L-2,3-Diaminopropanoate | KEGG COMPOUND |
| L-2,3-Diaminopropanoic acid | KEGG COMPOUND |
| L-2,3-Diaminopropionate | KEGG COMPOUND |
| L-2,3-Diaminopropionic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2,3-Diaminopropionic_acid | Wikipedia |
| C03401 | KEGG COMPOUND |
| DPP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721400 | Reaxys |
| CAS:4033-39-0 | KEGG COMPOUND |
| CAS:4033-39-0 | ChemIDplus |
| Citations |
|---|