EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8N2O2 |
| Net Charge | 0 |
| Average Mass | 104.109 |
| Monoisotopic Mass | 104.05858 |
| SMILES | NC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | PECYZEOJVXMISF-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-D-alanine (CHEBI:136598) is a D-alanine derivative (CHEBI:83944) |
| 3-amino-D-alanine (CHEBI:136598) is a 3-aminoalanine (CHEBI:18383) |
| 3-amino-D-alanine (CHEBI:136598) is enantiomer of 3-amino-L-alanine (CHEBI:16303) |
| 3-amino-D-alanine (CHEBI:136598) is tautomer of 3-amino-D-alanine zwitterion (CHEBI:136599) |
| Incoming Relation(s) |
| 3-amino-L-alanine (CHEBI:16303) is enantiomer of 3-amino-D-alanine (CHEBI:136598) |
| 3-amino-D-alanine zwitterion (CHEBI:136599) is tautomer of 3-amino-D-alanine (CHEBI:136598) |
| IUPAC Name |
|---|
| 3-amino-D-alanine |
| Synonyms | Source |
|---|---|
| (2R)-2,3-bis(azanyl)propanoic acid | PDBeChem |
| (2R)-2,3-diaminopropanoic acid | IUPAC |
| (2R)-2,3-diaminopropionic acid | ChEBI |
| (R)-2,3-diaminopropanoic acid | ChEBI |
| (R)-2,3-diaminopropionic acid | ChEBI |
| D-2,3-diaminopropanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2RA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721399 | Reaxys |
| CAS:1915-96-4 | ChEBI |
| Citations |
|---|