EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O10 |
| Net Charge | 0 |
| Average Mass | 354.267 |
| Monoisotopic Mass | 354.05870 |
| SMILES | O=C(O)CC(C(=O)O)C(OC(=O)/C=C\c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C15H14O10/c16-9-3-1-7(5-10(9)17)2-4-12(20)25-13(15(23)24)8(14(21)22)6-11(18)19/h1-5,8,13,16-17H,6H2,(H,18,19)(H,21,22)(H,23,24)/b4-2- |
| InChIKey | KYSQDMNDMYECNZ-RQOWECAXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-caffeoylisocitric acid (CHEBI:16166) has functional parent isocitric acid (CHEBI:30887) |
| 2-caffeoylisocitric acid (CHEBI:16166) is a tricarboxylic acid (CHEBI:27093) |
| 2-caffeoylisocitric acid (CHEBI:16166) is conjugate acid of 2-caffeoylisocitrate(3−) (CHEBI:57663) |
| Incoming Relation(s) |
| 2-caffeoylisocitrate(3−) (CHEBI:57663) is conjugate base of 2-caffeoylisocitric acid (CHEBI:16166) |
| IUPAC Name |
|---|
| 1-{[(2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}propane-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 2-Caffeoylisocitrate | KEGG COMPOUND |
| (E)-Caffeoylisocitrate | KEGG COMPOUND |